C12H18FNOS — CID 107525321
3-[2-amino-2-(3-fluorophenyl)ethyl]sulfanyl-2-methylpropan-1-ol (PubChem CID 107525321) has the molecular formula C12H18FNOS and a molecular weight of 243.35 g/mol. Its IUPAC name is 3-[2-amino-2-(3-fluorophenyl)ethyl]sulfanyl-2-methylpropan-1-ol.
| Compound Name | 3-[2-amino-2-(3-fluorophenyl)ethyl]sulfanyl-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 107525321 |
| Molecular Formula | C12H18FNOS |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 3-[2-amino-2-(3-fluorophenyl)ethyl]sulfanyl-2-methylpropan-1-ol |
| SMILES | CC(CO)CSCC(N)c1cccc(F)c1 |
| InChI | InChI=1S/C12H18FNOS/c1-9(6-15)7-16-8-12(14)10-3-2-4-11(13)5-10/h2-5,9,12,15H,6-8,14H2,1H3 |
| InChIKey | SQUCMSFWGMFGTN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |