C14H12F3NS — CID 107524316
2-(2,4-difluorophenyl)sulfanyl-1-(3-fluorophenyl)ethanamine (PubChem CID 107524316) has the molecular formula C14H12F3NS and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-1-(3-fluorophenyl)ethanamine.
| Compound Name | 2-(2,4-difluorophenyl)sulfanyl-1-(3-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 107524316 |
| Molecular Formula | C14H12F3NS |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanyl-1-(3-fluorophenyl)ethanamine |
| SMILES | NC(CSc1ccc(F)cc1F)c1cccc(F)c1 |
| InChI | InChI=1S/C14H12F3NS/c15-10-3-1-2-9(6-10)13(18)8-19-14-5-4-11(16)7-12(14)17/h1-7,13H,8,18H2 |
| InChIKey | IWXCNIYYBMXURR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |