C14H23NO2S — CID 66105221
3-[2-amino-2-(2-methoxy-5-methylphenyl)ethyl]sulfanyl-2-methylpropan-1-ol (PubChem CID 66105221) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 3-[2-amino-2-(2-methoxy-5-methylphenyl)ethyl]sulfanyl-2-methylpropan-1-ol.
| Compound Name | 3-[2-amino-2-(2-methoxy-5-methylphenyl)ethyl]sulfanyl-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 66105221 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-[2-amino-2-(2-methoxy-5-methylphenyl)ethyl]sulfanyl-2-methylpropan-1-ol |
| SMILES | COc1ccc(C)cc1C(N)CSCC(C)CO |
| InChI | InChI=1S/C14H23NO2S/c1-10-4-5-14(17-3)12(6-10)13(15)9-18-8-11(2)7-16/h4-6,11,13,16H,7-9,15H2,1-3H3 |
| InChIKey | SRRDPCOJWJNJBD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |