C10H17N3O — CID 105206412
[3-methoxy-1-(4-methyl-3-pyridinyl)propyl]hydrazine (PubChem CID 105206412) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is [3-methoxy-1-(4-methyl-3-pyridinyl)propyl]hydrazine.
| Compound Name | [3-methoxy-1-(4-methyl-3-pyridinyl)propyl]hydrazine |
|---|---|
| PubChem CID | 105206412 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | [3-methoxy-1-(4-methyl-3-pyridinyl)propyl]hydrazine |
| SMILES | COCCC(NN)c1cnccc1C |
| InChI | InChI=1S/C10H17N3O/c1-8-3-5-12-7-9(8)10(13-11)4-6-14-2/h3,5,7,10,13H,4,6,11H2,1-2H3 |
| InChIKey | OPMBZZWYKOMGJD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|