C11H18FN3O2 — CID 102930056
[1-(3-fluoro-4-pyridinyl)-3-(2-methoxyethoxy)propyl]hydrazine (PubChem CID 102930056) has the molecular formula C11H18FN3O2 and a molecular weight of 243.28 g/mol. Its IUPAC name is [1-(3-fluoro-4-pyridinyl)-3-(2-methoxyethoxy)propyl]hydrazine.
| Compound Name | [1-(3-fluoro-4-pyridinyl)-3-(2-methoxyethoxy)propyl]hydrazine |
|---|---|
| PubChem CID | 102930056 |
| Molecular Formula | C11H18FN3O2 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | [1-(3-fluoro-4-pyridinyl)-3-(2-methoxyethoxy)propyl]hydrazine |
| SMILES | COCCOCCC(NN)c1ccncc1F |
| InChI | InChI=1S/C11H18FN3O2/c1-16-6-7-17-5-3-11(15-13)9-2-4-14-8-10(9)12/h2,4,8,11,15H,3,5-7,13H2,1H3 |
| InChIKey | CTTVHCINHJFEEQ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|