C10H15FN2O — CID 104738162
1-(3-fluoro-4-pyridinyl)-3-methoxy-N-methylpropan-1-amine (PubChem CID 104738162) has the molecular formula C10H15FN2O and a molecular weight of 198.24 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyridinyl)-3-methoxy-N-methylpropan-1-amine.
| Compound Name | 1-(3-fluoro-4-pyridinyl)-3-methoxy-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 104738162 |
| Molecular Formula | C10H15FN2O |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1-(3-fluoro-4-pyridinyl)-3-methoxy-N-methylpropan-1-amine |
| SMILES | CNC(CCOC)c1ccncc1F |
| InChI | InChI=1S/C10H15FN2O/c1-12-10(4-6-14-2)8-3-5-13-7-9(8)11/h3,5,7,10,12H,4,6H2,1-2H3 |
| InChIKey | WFKUONIOMCNZBR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |