C10H15FN2O2 — CID 104739344
1-(3-fluoro-4-pyridinyl)-2-(2-methoxyethylamino)ethanol (PubChem CID 104739344) has the molecular formula C10H15FN2O2 and a molecular weight of 214.24 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyridinyl)-2-(2-methoxyethylamino)ethanol.
| Compound Name | 1-(3-fluoro-4-pyridinyl)-2-(2-methoxyethylamino)ethanol |
|---|---|
| PubChem CID | 104739344 |
| Molecular Formula | C10H15FN2O2 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 1-(3-fluoro-4-pyridinyl)-2-(2-methoxyethylamino)ethanol |
| SMILES | COCCNCC(O)c1ccncc1F |
| InChI | InChI=1S/C10H15FN2O2/c1-15-5-4-13-7-10(14)8-2-3-12-6-9(8)11/h2-3,6,10,13-14H,4-5,7H2,1H3 |
| InChIKey | VYPRXOILCNHZAB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|