C11H17FN2S — CID 104738272
1-(3-fluoro-4-pyridinyl)-N-methyl-2-propylsulfanylethanamine (PubChem CID 104738272) has the molecular formula C11H17FN2S and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyridinyl)-N-methyl-2-propylsulfanylethanamine.
| Compound Name | 1-(3-fluoro-4-pyridinyl)-N-methyl-2-propylsulfanylethanamine |
|---|---|
| PubChem CID | 104738272 |
| Molecular Formula | C11H17FN2S |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1-(3-fluoro-4-pyridinyl)-N-methyl-2-propylsulfanylethanamine |
| SMILES | CCCSCC(NC)c1ccncc1F |
| InChI | InChI=1S/C11H17FN2S/c1-3-6-15-8-11(13-2)9-4-5-14-7-10(9)12/h4-5,7,11,13H,3,6,8H2,1-2H3 |
| InChIKey | JAYHZYGJDCPGHN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|