C12H19FN2S — CID 104738270
N-[2-ethylsulfanyl-1-(3-fluoro-4-pyridinyl)ethyl]propan-1-amine (PubChem CID 104738270) has the molecular formula C12H19FN2S and a molecular weight of 242.36 g/mol. Its IUPAC name is N-[2-ethylsulfanyl-1-(3-fluoro-4-pyridinyl)ethyl]propan-1-amine.
| Compound Name | N-[2-ethylsulfanyl-1-(3-fluoro-4-pyridinyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 104738270 |
| Molecular Formula | C12H19FN2S |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | N-[2-ethylsulfanyl-1-(3-fluoro-4-pyridinyl)ethyl]propan-1-amine |
| SMILES | CCCNC(CSCC)c1ccncc1F |
| InChI | InChI=1S/C12H19FN2S/c1-3-6-15-12(9-16-4-2)10-5-7-14-8-11(10)13/h5,7-8,12,15H,3-4,6,9H2,1-2H3 |
| InChIKey | ZMOSLQKUISTIKX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |