C13H19BrFNS — CID 79743201
N-[1-(5-bromo-2-fluorophenyl)-2-ethylsulfanylethyl]propan-1-amine (PubChem CID 79743201) has the molecular formula C13H19BrFNS and a molecular weight of 320.27 g/mol. Its IUPAC name is N-[1-(5-bromo-2-fluorophenyl)-2-ethylsulfanylethyl]propan-1-amine.
| Compound Name | N-[1-(5-bromo-2-fluorophenyl)-2-ethylsulfanylethyl]propan-1-amine |
|---|---|
| PubChem CID | 79743201 |
| Molecular Formula | C13H19BrFNS |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-[1-(5-bromo-2-fluorophenyl)-2-ethylsulfanylethyl]propan-1-amine |
| SMILES | CCCNC(CSCC)c1cc(Br)ccc1F |
| InChI | InChI=1S/C13H19BrFNS/c1-3-7-16-13(9-17-4-2)11-8-10(14)5-6-12(11)15/h5-6,8,13,16H,3-4,7,9H2,1-2H3 |
| InChIKey | XSUDILOSXCXIJG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |