C16H18ClFN2S — CID 104738384
N-[2-(3-chlorophenyl)sulfanyl-1-(3-fluoro-4-pyridinyl)ethyl]propan-1-amine (PubChem CID 104738384) has the molecular formula C16H18ClFN2S and a molecular weight of 324.85 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)sulfanyl-1-(3-fluoro-4-pyridinyl)ethyl]propan-1-amine.
| Compound Name | N-[2-(3-chlorophenyl)sulfanyl-1-(3-fluoro-4-pyridinyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 104738384 |
| Molecular Formula | C16H18ClFN2S |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-[2-(3-chlorophenyl)sulfanyl-1-(3-fluoro-4-pyridinyl)ethyl]propan-1-amine |
| SMILES | CCCNC(CSc1cccc(Cl)c1)c1ccncc1F |
| InChI | InChI=1S/C16H18ClFN2S/c1-2-7-20-16(14-6-8-19-10-15(14)18)11-21-13-5-3-4-12(17)9-13/h3-6,8-10,16,20H,2,7,11H2,1H3 |
| InChIKey | WVHFJENKRVXOGG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |