C12H19FN2O2 — CID 104738508
N-[1-(3-fluoro-4-pyridinyl)-2,2-dimethoxyethyl]propan-1-amine (PubChem CID 104738508) has the molecular formula C12H19FN2O2 and a molecular weight of 242.29 g/mol. Its IUPAC name is N-[1-(3-fluoro-4-pyridinyl)-2,2-dimethoxyethyl]propan-1-amine.
| Compound Name | N-[1-(3-fluoro-4-pyridinyl)-2,2-dimethoxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 104738508 |
| Molecular Formula | C12H19FN2O2 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-[1-(3-fluoro-4-pyridinyl)-2,2-dimethoxyethyl]propan-1-amine |
| SMILES | CCCNC(c1ccncc1F)C(OC)OC |
| InChI | InChI=1S/C12H19FN2O2/c1-4-6-15-11(12(16-2)17-3)9-5-7-14-8-10(9)13/h5,7-8,11-12,15H,4,6H2,1-3H3 |
| InChIKey | YHYXTFIIAVDWDS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|