C12H17F2NS — CID 65129194
1-(2,6-difluorophenyl)-N-methyl-2-propylsulfanylethanamine (PubChem CID 65129194) has the molecular formula C12H17F2NS and a molecular weight of 245.34 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-N-methyl-2-propylsulfanylethanamine.
| Compound Name | 1-(2,6-difluorophenyl)-N-methyl-2-propylsulfanylethanamine |
|---|---|
| PubChem CID | 65129194 |
| Molecular Formula | C12H17F2NS |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-(2,6-difluorophenyl)-N-methyl-2-propylsulfanylethanamine |
| SMILES | CCCSCC(NC)c1c(F)cccc1F |
| InChI | InChI=1S/C12H17F2NS/c1-3-7-16-8-11(15-2)12-9(13)5-4-6-10(12)14/h4-6,11,15H,3,7-8H2,1-2H3 |
| InChIKey | CVRGYQLTWDKMIF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|