C13H17F4NS — CID 107288956
1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methyl-2-propylsulfanylethanamine (PubChem CID 107288956) has the molecular formula C13H17F4NS and a molecular weight of 295.35 g/mol. Its IUPAC name is 1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methyl-2-propylsulfanylethanamine.
| Compound Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methyl-2-propylsulfanylethanamine |
|---|---|
| PubChem CID | 107288956 |
| Molecular Formula | C13H17F4NS |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methyl-2-propylsulfanylethanamine |
| SMILES | CCCSCC(NC)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F4NS/c1-3-6-19-8-12(18-2)9-4-5-11(14)10(7-9)13(15,16)17/h4-5,7,12,18H,3,6,8H2,1-2H3 |
| InChIKey | QBDXRAIHQBFPSM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|