C14H12BrF4NS — CID 115841034
2-(5-bromothiophen-2-yl)-1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methylethanamine (PubChem CID 115841034) has the molecular formula C14H12BrF4NS and a molecular weight of 382.22 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methylethanamine.
| Compound Name | 2-(5-bromothiophen-2-yl)-1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 115841034 |
| Molecular Formula | C14H12BrF4NS |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methylethanamine |
| SMILES | CNC(Cc1ccc(Br)s1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12BrF4NS/c1-20-12(7-9-3-5-13(15)21-9)8-2-4-11(16)10(6-8)14(17,18)19/h2-6,12,20H,7H2,1H3 |
| InChIKey | UNRIQYSCARRAGE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |