C15H25FN2 — CID 114200992
N-ethyl-1-(3-fluoro-4-pyridinyl)-3,5-dimethylhexan-1-amine (PubChem CID 114200992) has the molecular formula C15H25FN2 and a molecular weight of 252.38 g/mol. Its IUPAC name is N-ethyl-1-(3-fluoro-4-pyridinyl)-3,5-dimethylhexan-1-amine.
| Compound Name | N-ethyl-1-(3-fluoro-4-pyridinyl)-3,5-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 114200992 |
| Molecular Formula | C15H25FN2 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | N-ethyl-1-(3-fluoro-4-pyridinyl)-3,5-dimethylhexan-1-amine |
| SMILES | CCNC(CC(C)CC(C)C)c1ccncc1F |
| InChI | InChI=1S/C15H25FN2/c1-5-18-15(9-12(4)8-11(2)3)13-6-7-17-10-14(13)16/h6-7,10-12,15,18H,5,8-9H2,1-4H3 |
| InChIKey | NMQIIEJZYWMOHI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |