C14H24ClF2N3O — CID 103150042
1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-3-(2,2-difluoroethoxy)-N-propylpropan-1-amine (PubChem CID 103150042) has the molecular formula C14H24ClF2N3O and a molecular weight of 323.82 g/mol. Its IUPAC name is 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-3-(2,2-difluoroethoxy)-N-propylpropan-1-amine.
| Compound Name | 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-3-(2,2-difluoroethoxy)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 103150042 |
| Molecular Formula | C14H24ClF2N3O |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-3-(2,2-difluoroethoxy)-N-propylpropan-1-amine |
| SMILES | CCCNC(CCOCC(F)F)c1c(Cl)cnn1C(C)C |
| InChI | InChI=1S/C14H24ClF2N3O/c1-4-6-18-12(5-7-21-9-13(16)17)14-11(15)8-19-20(14)10(2)3/h8,10,12-13,18H,4-7,9H2,1-3H3 |
| InChIKey | GWLDKRGTTRDXOU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|