C14H26ClN3 — CID 114657470
1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-propylpentan-1-amine (PubChem CID 114657470) has the molecular formula C14H26ClN3 and a molecular weight of 271.84 g/mol. Its IUPAC name is 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-propylpentan-1-amine.
| Compound Name | 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 114657470 |
| Molecular Formula | C14H26ClN3 |
| Molecular Weight | 271.84 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-propylpentan-1-amine |
| SMILES | CCCCC(NCCC)c1c(Cl)cnn1C(C)C |
| InChI | InChI=1S/C14H26ClN3/c1-5-7-8-13(16-9-6-2)14-12(15)10-17-18(14)11(3)4/h10-11,13,16H,5-9H2,1-4H3 |
| InChIKey | QHGLPGKYIHADHF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.84 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |