C14H26ClN3S — CID 114653705
N-[1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-propan-2-ylsulfanylethyl]propan-1-amine (PubChem CID 114653705) has the molecular formula C14H26ClN3S and a molecular weight of 303.90 g/mol. Its IUPAC name is N-[1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-propan-2-ylsulfanylethyl]propan-1-amine.
| Compound Name | N-[1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-propan-2-ylsulfanylethyl]propan-1-amine |
|---|---|
| PubChem CID | 114653705 |
| Molecular Formula | C14H26ClN3S |
| Molecular Weight | 303.90 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N-[1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-propan-2-ylsulfanylethyl]propan-1-amine |
| SMILES | CCCNC(CSC(C)C)c1c(Cl)cnn1C(C)C |
| InChI | InChI=1S/C14H26ClN3S/c1-6-7-16-13(9-19-11(4)5)14-12(15)8-17-18(14)10(2)3/h8,10-11,13,16H,6-7,9H2,1-5H3 |
| InChIKey | PKZDIGLEGVAWIY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |