C12H22ClN3S — CID 114653517
N-[1-(4-chloro-1-ethylpyrazol-5-yl)-2-ethylsulfanylethyl]propan-1-amine (PubChem CID 114653517) has the molecular formula C12H22ClN3S and a molecular weight of 275.85 g/mol. Its IUPAC name is N-[1-(4-chloro-1-ethylpyrazol-5-yl)-2-ethylsulfanylethyl]propan-1-amine.
| Compound Name | N-[1-(4-chloro-1-ethylpyrazol-5-yl)-2-ethylsulfanylethyl]propan-1-amine |
|---|---|
| PubChem CID | 114653517 |
| Molecular Formula | C12H22ClN3S |
| Molecular Weight | 275.85 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-[1-(4-chloro-1-ethylpyrazol-5-yl)-2-ethylsulfanylethyl]propan-1-amine |
| SMILES | CCCNC(CSCC)c1c(Cl)cnn1CC |
| InChI | InChI=1S/C12H22ClN3S/c1-4-7-14-11(9-17-6-3)12-10(13)8-15-16(12)5-2/h8,11,14H,4-7,9H2,1-3H3 |
| InChIKey | GZMFVZYKWDMHER-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.85 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |