C14H19BrClN3S — CID 114652806
N-[(4-bromothiophen-2-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methyl]propan-1-amine (PubChem CID 114652806) has the molecular formula C14H19BrClN3S and a molecular weight of 376.75 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methyl]propan-1-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 114652806 |
| Molecular Formula | C14H19BrClN3S |
| Molecular Weight | 376.75 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cc(Br)cs1)c1c(Cl)cnn1C(C)C |
| InChI | InChI=1S/C14H19BrClN3S/c1-4-5-17-13(12-6-10(15)8-20-12)14-11(16)7-18-19(14)9(2)3/h6-9,13,17H,4-5H2,1-3H3 |
| InChIKey | UKMAHZGUEAJGPR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.75 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |