C11H14BrClN4S — CID 105222643
[(4-bromothiophen-2-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methyl]hydrazine (PubChem CID 105222643) has the molecular formula C11H14BrClN4S and a molecular weight of 349.69 g/mol. Its IUPAC name is [(4-bromothiophen-2-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methyl]hydrazine.
| Compound Name | [(4-bromothiophen-2-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105222643 |
| Molecular Formula | C11H14BrClN4S |
| Molecular Weight | 349.69 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | [(4-bromothiophen-2-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methyl]hydrazine |
| SMILES | CC(C)n1ncc(Cl)c1C(NN)c1cc(Br)cs1 |
| InChI | InChI=1S/C11H14BrClN4S/c1-6(2)17-11(8(13)4-15-17)10(16-14)9-3-7(12)5-18-9/h3-6,10,16H,14H2,1-2H3 |
| InChIKey | OGCOPSNZVBOGNH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.69 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|