C9H13ClN6S — CID 105336778
[(4-chloro-1-propan-2-ylpyrazol-5-yl)-(thiadiazol-4-yl)methyl]hydrazine (PubChem CID 105336778) has the molecular formula C9H13ClN6S and a molecular weight of 272.76 g/mol. Its IUPAC name is [(4-chloro-1-propan-2-ylpyrazol-5-yl)-(thiadiazol-4-yl)methyl]hydrazine.
| Compound Name | [(4-chloro-1-propan-2-ylpyrazol-5-yl)-(thiadiazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105336778 |
| Molecular Formula | C9H13ClN6S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | [(4-chloro-1-propan-2-ylpyrazol-5-yl)-(thiadiazol-4-yl)methyl]hydrazine |
| SMILES | CC(C)n1ncc(Cl)c1C(NN)c1csnn1 |
| InChI | InChI=1S/C9H13ClN6S/c1-5(2)16-9(6(10)3-12-16)8(13-11)7-4-17-15-14-7/h3-5,8,13H,11H2,1-2H3 |
| InChIKey | AWXYHMBXTGOBJM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|