C9H12ClN5OS — CID 105189953
[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(thiadiazol-4-yl)methanamine (PubChem CID 105189953) has the molecular formula C9H12ClN5OS and a molecular weight of 273.75 g/mol. Its IUPAC name is [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(thiadiazol-4-yl)methanamine.
| Compound Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(thiadiazol-4-yl)methanamine |
|---|---|
| PubChem CID | 105189953 |
| Molecular Formula | C9H12ClN5OS |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(thiadiazol-4-yl)methanamine |
| SMILES | COCCn1ncc(Cl)c1C(N)c1csnn1 |
| InChI | InChI=1S/C9H12ClN5OS/c1-16-3-2-15-9(6(10)4-12-15)8(11)7-5-17-14-13-7/h4-5,8H,2-3,11H2,1H3 |
| InChIKey | KHCCYMDGOGZXJL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |