C11H16ClN5OS — CID 105189938
[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4-ethylthiadiazol-5-yl)methanamine (PubChem CID 105189938) has the molecular formula C11H16ClN5OS and a molecular weight of 301.80 g/mol. Its IUPAC name is [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4-ethylthiadiazol-5-yl)methanamine.
| Compound Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4-ethylthiadiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 105189938 |
| Molecular Formula | C11H16ClN5OS |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4-ethylthiadiazol-5-yl)methanamine |
| SMILES | CCc1nnsc1C(N)c1c(Cl)cnn1CCOC |
| InChI | InChI=1S/C11H16ClN5OS/c1-3-8-11(19-16-15-8)9(13)10-7(12)6-14-17(10)4-5-18-2/h6,9H,3-5,13H2,1-2H3 |
| InChIKey | MGAJKQKHJBRUBH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |