C13H19ClN4O2S — CID 105132690
(4-tert-butylthiadiazol-5-yl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanol (PubChem CID 105132690) has the molecular formula C13H19ClN4O2S and a molecular weight of 330.84 g/mol. Its IUPAC name is (4-tert-butylthiadiazol-5-yl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanol.
| Compound Name | (4-tert-butylthiadiazol-5-yl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanol |
|---|---|
| PubChem CID | 105132690 |
| Molecular Formula | C13H19ClN4O2S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (4-tert-butylthiadiazol-5-yl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanol |
| SMILES | COCCn1ncc(Cl)c1C(O)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C13H19ClN4O2S/c1-13(2,3)12-11(21-17-16-12)10(19)9-8(14)7-15-18(9)5-6-20-4/h7,10,19H,5-6H2,1-4H3 |
| InChIKey | YYFFMWBTNKDWDN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |