C12H15ClN2O3S — CID 115839360
[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4-methoxythiophen-2-yl)methanol (PubChem CID 115839360) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4-methoxythiophen-2-yl)methanol.
| Compound Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4-methoxythiophen-2-yl)methanol |
|---|---|
| PubChem CID | 115839360 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4-methoxythiophen-2-yl)methanol |
| SMILES | COCCn1ncc(Cl)c1C(O)c1cc(OC)cs1 |
| InChI | InChI=1S/C12H15ClN2O3S/c1-17-4-3-15-11(9(13)6-14-15)12(16)10-5-8(18-2)7-19-10/h5-7,12,16H,3-4H2,1-2H3 |
| InChIKey | UGFJHBDBBFBMDB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |