C9H11ClN4O2S — CID 105132660
[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(thiadiazol-4-yl)methanol (PubChem CID 105132660) has the molecular formula C9H11ClN4O2S and a molecular weight of 274.73 g/mol. Its IUPAC name is [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(thiadiazol-4-yl)methanol.
| Compound Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(thiadiazol-4-yl)methanol |
|---|---|
| PubChem CID | 105132660 |
| Molecular Formula | C9H11ClN4O2S |
| Molecular Weight | 274.73 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(thiadiazol-4-yl)methanol |
| SMILES | COCCn1ncc(Cl)c1C(O)c1csnn1 |
| InChI | InChI=1S/C9H11ClN4O2S/c1-16-3-2-14-8(6(10)4-11-14)9(15)7-5-17-13-12-7/h4-5,9,15H,2-3H2,1H3 |
| InChIKey | LQJPQLDRBJPDDY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.73 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |