C10H15ClN6O — CID 112735905
[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(1-methyltriazol-4-yl)methanamine (PubChem CID 112735905) has the molecular formula C10H15ClN6O and a molecular weight of 270.72 g/mol. Its IUPAC name is [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(1-methyltriazol-4-yl)methanamine.
| Compound Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(1-methyltriazol-4-yl)methanamine |
|---|---|
| PubChem CID | 112735905 |
| Molecular Formula | C10H15ClN6O |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | [4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(1-methyltriazol-4-yl)methanamine |
| SMILES | COCCn1ncc(Cl)c1C(N)c1cn(C)nn1 |
| InChI | InChI=1S/C10H15ClN6O/c1-16-6-8(14-15-16)9(12)10-7(11)5-13-17(10)3-4-18-2/h5-6,9H,3-4,12H2,1-2H3 |
| InChIKey | KWXJHAOCEDPDBY-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |