C15H16ClF2NS — CID 82771763
N-[1-(4-chloro-2,5-difluorophenyl)-2-thiophen-2-ylethyl]propan-1-amine (PubChem CID 82771763) has the molecular formula C15H16ClF2NS and a molecular weight of 315.82 g/mol. Its IUPAC name is N-[1-(4-chloro-2,5-difluorophenyl)-2-thiophen-2-ylethyl]propan-1-amine.
| Compound Name | N-[1-(4-chloro-2,5-difluorophenyl)-2-thiophen-2-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 82771763 |
| Molecular Formula | C15H16ClF2NS |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-[1-(4-chloro-2,5-difluorophenyl)-2-thiophen-2-ylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cccs1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C15H16ClF2NS/c1-2-5-19-15(7-10-4-3-6-20-10)11-8-14(18)12(16)9-13(11)17/h3-4,6,8-9,15,19H,2,5,7H2,1H3 |
| InChIKey | LGJSAVPCJDDMCD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|