C14H16ClNO2S — CID 106042146
2-[1-[2-(5-chlorothiophen-2-yl)ethylamino]ethyl]benzene-1,3-diol (PubChem CID 106042146) has the molecular formula C14H16ClNO2S and a molecular weight of 297.81 g/mol. Its IUPAC name is 2-[1-[2-(5-chlorothiophen-2-yl)ethylamino]ethyl]benzene-1,3-diol.
| Compound Name | 2-[1-[2-(5-chlorothiophen-2-yl)ethylamino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 106042146 |
| Molecular Formula | C14H16ClNO2S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-[1-[2-(5-chlorothiophen-2-yl)ethylamino]ethyl]benzene-1,3-diol |
| SMILES | CC(NCCc1ccc(Cl)s1)c1c(O)cccc1O |
| InChI | InChI=1S/C14H16ClNO2S/c1-9(14-11(17)3-2-4-12(14)18)16-8-7-10-5-6-13(15)19-10/h2-6,9,16-18H,7-8H2,1H3 |
| InChIKey | QYHYOFPOSBRRDD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|