C13H18ClFN2 — CID 62975741
N-[(4-chloro-3-fluorophenyl)methyl]-N'-cyclopropyl-N'-methylethane-1,2-diamine (PubChem CID 62975741) has the molecular formula C13H18ClFN2 and a molecular weight of 256.75 g/mol. Its IUPAC name is N-[(4-chloro-3-fluorophenyl)methyl]-N'-cyclopropyl-N'-methylethane-1,2-diamine.
| Compound Name | N-[(4-chloro-3-fluorophenyl)methyl]-N'-cyclopropyl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62975741 |
| Molecular Formula | C13H18ClFN2 |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | N-[(4-chloro-3-fluorophenyl)methyl]-N'-cyclopropyl-N'-methylethane-1,2-diamine |
| SMILES | CN(CCNCc1ccc(Cl)c(F)c1)C1CC1 |
| InChI | InChI=1S/C13H18ClFN2/c1-17(11-3-4-11)7-6-16-9-10-2-5-12(14)13(15)8-10/h2,5,8,11,16H,3-4,6-7,9H2,1H3 |
| InChIKey | IMXPMDVARLTFGY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|