C14H14Cl2FN3O — CID 48529543
2,4-dichloro-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-5-fluorobenzamide (PubChem CID 48529543) has the molecular formula C14H14Cl2FN3O and a molecular weight of 330.19 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-5-fluorobenzamide.
| Compound Name | 2,4-dichloro-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 48529543 |
| Molecular Formula | C14H14Cl2FN3O |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2,4-dichloro-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-5-fluorobenzamide |
| SMILES | Cc1c(C(C)NC(=O)c2cc(F)c(Cl)cc2Cl)cnn1C |
| InChI | InChI=1S/C14H14Cl2FN3O/c1-7(10-6-18-20(3)8(10)2)19-14(21)9-4-13(17)12(16)5-11(9)15/h4-7H,1-3H3,(H,19,21) |
| InChIKey | QMQFSYCUIYHPDX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|