C15H18ClN3O2 — CID 19469091
5-chloro-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-methoxybenzamide (PubChem CID 19469091) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is 5-chloro-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 19469091 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 5-chloro-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NC(C)c1cnn(C)c1C |
| InChI | InChI=1S/C15H18ClN3O2/c1-9(13-8-17-19(3)10(13)2)18-15(20)12-7-11(16)5-6-14(12)21-4/h5-9H,1-4H3,(H,18,20) |
| InChIKey | GNZKKXULBNPVBN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |