C12H13ClN4O2 — CID 103716401
5-chloro-2-methoxy-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide (PubChem CID 103716401) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.72 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 103716401 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 5-chloro-2-methoxy-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C12H13ClN4O2/c1-7(11-14-6-15-17-11)16-12(18)9-5-8(13)3-4-10(9)19-2/h3-7H,1-2H3,(H,16,18)(H,14,15,17) |
| InChIKey | FKAHEMCEYFRAKJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |