C14H14ClF2N3O — CID 94802139
2-chloro-N-[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-4,5-difluorobenzamide (PubChem CID 94802139) has the molecular formula C14H14ClF2N3O and a molecular weight of 313.74 g/mol. Its IUPAC name is 2-chloro-N-[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 94802139 |
| Molecular Formula | C14H14ClF2N3O |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-chloro-N-[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-4,5-difluorobenzamide |
| SMILES | Cc1c([C@@H](C)NC(=O)c2cc(F)c(F)cc2Cl)cnn1C |
| InChI | InChI=1S/C14H14ClF2N3O/c1-7(10-6-18-20(3)8(10)2)19-14(21)9-4-12(16)13(17)5-11(9)15/h4-7H,1-3H3,(H,19,21)/t7-/m1/s1 |
| InChIKey | SFXJBTGNHLXMFY-SSDOTTSWSA-N |
| XLogP | 3.15 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|