C21H23ClFNO3 — CID 91782922
3-(2-chlorophenyl)-N-[(3-fluoro-4-methoxyphenyl)-(3-hydroxycyclobutyl)methyl]propanamide (PubChem CID 91782922) has the molecular formula C21H23ClFNO3 and a molecular weight of 391.87 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[(3-fluoro-4-methoxyphenyl)-(3-hydroxycyclobutyl)methyl]propanamide.
| Compound Name | 3-(2-chlorophenyl)-N-[(3-fluoro-4-methoxyphenyl)-(3-hydroxycyclobutyl)methyl]propanamide |
|---|---|
| PubChem CID | 91782922 |
| Molecular Formula | C21H23ClFNO3 |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[(3-fluoro-4-methoxyphenyl)-(3-hydroxycyclobutyl)methyl]propanamide |
| SMILES | COc1ccc(C(NC(=O)CCc2ccccc2Cl)C2CC(O)C2)cc1F |
| InChI | InChI=1S/C21H23ClFNO3/c1-27-19-8-6-14(12-18(19)23)21(15-10-16(25)11-15)24-20(26)9-7-13-4-2-3-5-17(13)22/h2-6,8,12,15-16,21,25H,7,9-11H2,1H3,(H,24,26) |
| InChIKey | HRVWNVHJYGZEHQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |