C16H22FNO3S — CID 91770108
N-[(3-fluoro-4-methoxyphenyl)-(3-hydroxycyclobutyl)methyl]-3-methylsulfanylpropanamide (PubChem CID 91770108) has the molecular formula C16H22FNO3S and a molecular weight of 327.42 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)-(3-hydroxycyclobutyl)methyl]-3-methylsulfanylpropanamide.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)-(3-hydroxycyclobutyl)methyl]-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 91770108 |
| Molecular Formula | C16H22FNO3S |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)-(3-hydroxycyclobutyl)methyl]-3-methylsulfanylpropanamide |
| SMILES | COc1ccc(C(NC(=O)CCSC)C2CC(O)C2)cc1F |
| InChI | InChI=1S/C16H22FNO3S/c1-21-14-4-3-10(9-13(14)17)16(11-7-12(19)8-11)18-15(20)5-6-22-2/h3-4,9,11-12,16,19H,5-8H2,1-2H3,(H,18,20) |
| InChIKey | APRFJDUMUHCGTK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |