C19H22FNO4S — CID 91782344
N-[(3-fluoro-4-methoxyphenyl)-(3-hydroxycyclobutyl)methyl]-4-methylbenzenesulfonamide (PubChem CID 91782344) has the molecular formula C19H22FNO4S and a molecular weight of 379.45 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)-(3-hydroxycyclobutyl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)-(3-hydroxycyclobutyl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 91782344 |
| Molecular Formula | C19H22FNO4S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)-(3-hydroxycyclobutyl)methyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(C(NS(=O)(=O)c2ccc(C)cc2)C2CC(O)C2)cc1F |
| InChI | InChI=1S/C19H22FNO4S/c1-12-3-6-16(7-4-12)26(23,24)21-19(14-9-15(22)10-14)13-5-8-18(25-2)17(20)11-13/h3-8,11,14-15,19,21-22H,9-10H2,1-2H3 |
| InChIKey | XBASCGPLRQQFPJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |