C14H15N3O2 — CID 69335715
2-(2,4-diaminophenyl)-N-(2-hydroxyphenyl)acetamide (PubChem CID 69335715) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-(2,4-diaminophenyl)-N-(2-hydroxyphenyl)acetamide.
| Compound Name | 2-(2,4-diaminophenyl)-N-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 69335715 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-(2,4-diaminophenyl)-N-(2-hydroxyphenyl)acetamide |
| SMILES | Nc1ccc(CC(=O)Nc2ccccc2O)c(N)c1 |
| InChI | InChI=1S/C14H15N3O2/c15-10-6-5-9(11(16)8-10)7-14(19)17-12-3-1-2-4-13(12)18/h1-6,8,18H,7,15-16H2,(H,17,19) |
| InChIKey | HDEFDPUGFLATNK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|