C15H16N2O2 — CID 142686542
2-(4,6-dimethyl-3-pyridinyl)-N-(2-hydroxyphenyl)acetamide (PubChem CID 142686542) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-(4,6-dimethyl-3-pyridinyl)-N-(2-hydroxyphenyl)acetamide.
| Compound Name | 2-(4,6-dimethyl-3-pyridinyl)-N-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 142686542 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-(4,6-dimethyl-3-pyridinyl)-N-(2-hydroxyphenyl)acetamide |
| SMILES | Cc1cc(C)c(CC(=O)Nc2ccccc2O)cn1 |
| InChI | InChI=1S/C15H16N2O2/c1-10-7-11(2)16-9-12(10)8-15(19)17-13-5-3-4-6-14(13)18/h3-7,9,18H,8H2,1-2H3,(H,17,19) |
| InChIKey | LAWFSAXCHXXDDL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|