C16H14N2O2 — CID 107799235
N-(2-cyano-3-methylphenyl)-2-(2-hydroxyphenyl)acetamide (PubChem CID 107799235) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-(2-cyano-3-methylphenyl)-2-(2-hydroxyphenyl)acetamide.
| Compound Name | N-(2-cyano-3-methylphenyl)-2-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 107799235 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-(2-cyano-3-methylphenyl)-2-(2-hydroxyphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cc2ccccc2O)c1C#N |
| InChI | InChI=1S/C16H14N2O2/c1-11-5-4-7-14(13(11)10-17)18-16(20)9-12-6-2-3-8-15(12)19/h2-8,19H,9H2,1H3,(H,18,20) |
| InChIKey | KISPQCUKYMAVGB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |