C11H13N3O — CID 103710079
1-(2-cyano-3-methylphenyl)-3-ethylurea (PubChem CID 103710079) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-(2-cyano-3-methylphenyl)-3-ethylurea.
| Compound Name | 1-(2-cyano-3-methylphenyl)-3-ethylurea |
|---|---|
| PubChem CID | 103710079 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-(2-cyano-3-methylphenyl)-3-ethylurea |
| SMILES | CCNC(=O)Nc1cccc(C)c1C#N |
| InChI | InChI=1S/C11H13N3O/c1-3-13-11(15)14-10-6-4-5-8(2)9(10)7-12/h4-6H,3H2,1-2H3,(H2,13,14,15) |
| InChIKey | OAWGNSFCUPWHKL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |