C14H17N3O3 — CID 107799883
2-[(2-cyano-3-methylphenyl)carbamoylamino]pentanoic acid (PubChem CID 107799883) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[(2-cyano-3-methylphenyl)carbamoylamino]pentanoic acid.
| Compound Name | 2-[(2-cyano-3-methylphenyl)carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 107799883 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-[(2-cyano-3-methylphenyl)carbamoylamino]pentanoic acid |
| SMILES | CCCC(NC(=O)Nc1cccc(C)c1C#N)C(=O)O |
| InChI | InChI=1S/C14H17N3O3/c1-3-5-12(13(18)19)17-14(20)16-11-7-4-6-9(2)10(11)8-15/h4,6-7,12H,3,5H2,1-2H3,(H,18,19)(H2,16,17,20) |
| InChIKey | SLVDSCBYFGEKIO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |