About 2-aminophenol;N-(2-hydroxyphenyl)-2-phenylacetamide
2-aminophenol;N-(2-hydroxyphenyl)-2-phenylacetamide (PubChem CID 158675844) has the molecular formula C20H20N2O3
and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-aminophenol;N-(2-hydroxyphenyl)-2-phenylacetamide.
Molecular Properties
| Compound Name | 2-aminophenol;N-(2-hydroxyphenyl)-2-phenylacetamide |
| PubChem CID | 158675844 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-aminophenol;N-(2-hydroxyphenyl)-2-phenylacetamide |
| SMILES | Nc1ccccc1O.O=C(Cc1ccccc1)Nc1ccccc1O |
| InChI | InChI=1S/C14H13NO2.C6H7NO/c16-13-9-5-4-8-12(13)15-14(17)10-11-6-2-1-3-7-11;7-5-3-1-2-4-6(5)8/h1-9,16H,10H2,(H,15,17);1-4,8H,7H2 |
| InChIKey | IEMVTFIXXAYQNJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-aminophenol;N-(2-hydroxyphenyl)-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminophenol;N-(2-hydroxyphenyl)-2-phenylacetamide?
The IUPAC name of 2-aminophenol;N-(2-hydroxyphenyl)-2-phenylacetamide (CID 158675844) is 2-aminophenol;N-(2-hydroxyphenyl)-2-phenylacetamide.
What is the SMILES notation for 2-aminophenol;N-(2-hydroxyphenyl)-2-phenylacetamide?
The canonical SMILES for 2-aminophenol;N-(2-hydroxyphenyl)-2-phenylacetamide is Nc1ccccc1O.O=C(Cc1ccccc1)Nc1ccccc1O.
What is the InChIKey of 2-aminophenol;N-(2-hydroxyphenyl)-2-phenylacetamide?
The InChIKey is IEMVTFIXXAYQNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2.C6H7NO/c16-13-9-5-4-8-12(13)15-14(17)10-11-6-2-1-3-7-11;7-5-3-1-2-4-6(5)8/h1-9,16H,10H2,(H,15,17);1-4,8H,7H2.
What are the key properties of 2-aminophenol;N-(2-hydroxyphenyl)-2-phenylacetamide?
2-aminophenol;N-(2-hydroxyphenyl)-2-phenylacetamide has a molecular weight of 336.39 g/mol, XLogP of 3.55, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminophenol;N-(2-hydroxyphenyl)-2-phenylacetamide is sourced from PubChem (CID 158675844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).