C21H31N3O5S — CID 16607005
[2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 1-methylsulfonylpiperidine-4-carboxylate (PubChem CID 16607005) has the molecular formula C21H31N3O5S and a molecular weight of 437.56 g/mol. Its IUPAC name is [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 1-methylsulfonylpiperidine-4-carboxylate.
| Compound Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 1-methylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 16607005 |
| Molecular Formula | C21H31N3O5S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 1-methylsulfonylpiperidine-4-carboxylate |
| SMILES | CS(=O)(=O)N1CCC(C(=O)OCC(=O)Nc2ccc(N3CCCCCC3)cc2)CC1 |
| InChI | InChI=1S/C21H31N3O5S/c1-30(27,28)24-14-10-17(11-15-24)21(26)29-16-20(25)22-18-6-8-19(9-7-18)23-12-4-2-3-5-13-23/h6-9,17H,2-5,10-16H2,1H3,(H,22,25) |
| InChIKey | KTWUFMKAPAXBDU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|