C19H26N2O4 — CID 8808206
[2-[4-(azepan-1-yl)anilino]-2-oxoethyl] (2R)-oxolane-2-carboxylate (PubChem CID 8808206) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] (2R)-oxolane-2-carboxylate.
| Compound Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] (2R)-oxolane-2-carboxylate |
|---|---|
| PubChem CID | 8808206 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] (2R)-oxolane-2-carboxylate |
| SMILES | O=C(COC(=O)[C@H]1CCCO1)Nc1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C19H26N2O4/c22-18(14-25-19(23)17-6-5-13-24-17)20-15-7-9-16(10-8-15)21-11-3-1-2-4-12-21/h7-10,17H,1-6,11-14H2,(H,20,22)/t17-/m1/s1 |
| InChIKey | TZEHPXKDRBNGGL-QGZVFWFLSA-N |
| XLogP | 2.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|