C24H30N4O5 — CID 16625061
[2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate (PubChem CID 16625061) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is [2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate.
| Compound Name | [2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 16625061 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | [2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate |
| SMILES | CCN1CCN(c2ccc(NC(=O)COC(=O)CNC(=O)c3cccc(OC)c3)cc2)CC1 |
| InChI | InChI=1S/C24H30N4O5/c1-3-27-11-13-28(14-12-27)20-9-7-19(8-10-20)26-22(29)17-33-23(30)16-25-24(31)18-5-4-6-21(15-18)32-2/h4-10,15H,3,11-14,16-17H2,1-2H3,(H,25,31)(H,26,29) |
| InChIKey | VJZJTEPXJDBBQR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|