C20H21N3O7 — CID 31145131
[2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate (PubChem CID 31145131) has the molecular formula C20H21N3O7 and a molecular weight of 415.40 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate.
| Compound Name | [2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 31145131 |
| Molecular Formula | C20H21N3O7 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate |
| SMILES | COc1ccc(NC(=O)NC(=O)COC(=O)CNC(=O)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C20H21N3O7/c1-28-15-8-6-14(7-9-15)22-20(27)23-17(24)12-30-18(25)11-21-19(26)13-4-3-5-16(10-13)29-2/h3-10H,11-12H2,1-2H3,(H,21,26)(H2,22,23,24,27) |
| InChIKey | UDBPXWSYNKUNRU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |