C17H24N2O5 — CID 7881991
[2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate (PubChem CID 7881991) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is [2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate.
| Compound Name | [2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7881991 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-[(3-methoxybenzoyl)amino]acetate |
| SMILES | COc1cccc(C(=O)NCC(=O)OCC(=O)N[C@@H](C)C(C)C)c1 |
| InChI | InChI=1S/C17H24N2O5/c1-11(2)12(3)19-15(20)10-24-16(21)9-18-17(22)13-6-5-7-14(8-13)23-4/h5-8,11-12H,9-10H2,1-4H3,(H,18,22)(H,19,20)/t12-/m0/s1 |
| InChIKey | QANHVPACFGUEST-LBPRGKRZSA-N |
| XLogP | 1.13 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |